C7H10N4O3 — CID 63654157
2-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid (PubChem CID 63654157) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid.
| Compound Name | 2-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 63654157 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid |
| SMILES | CCC(NC(=O)c1ncn[nH]1)C(=O)O |
| InChI | InChI=1S/C7H10N4O3/c1-2-4(7(13)14)10-6(12)5-8-3-9-11-5/h3-4H,2H2,1H3,(H,10,12)(H,13,14)(H,8,9,11) |
| InChIKey | GGYZSSMPWZXSMY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |