About 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid
3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid (PubChem CID 63648096) has the molecular formula C6H8N4O4
and a molecular weight of 200.15 g/mol. Its IUPAC name is 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid.
Analyze 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid?
The IUPAC name of 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid (CID 63648096) is 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid.
What is the SMILES notation for 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid?
The canonical SMILES for 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid is O=C(NC(CO)C(=O)O)c1ncn[nH]1.
What is the InChIKey of 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid?
The InChIKey is VCLZBXKUIIKBQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O4/c11-1-3(6(13)14)9-5(12)4-7-2-8-10-4/h2-3,11H,1H2,(H,9,12)(H,13,14)(H,7,8,10).
What are the key properties of 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid?
3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid has a molecular weight of 200.15 g/mol, XLogP of -2.02, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-(1H-1,2,4-triazole-5-carbonylamino)propanoic acid is sourced from PubChem (CID 63648096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).