C7H13N5O — CID 65193517
N-(1-aminobutan-2-yl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 65193517) has the molecular formula C7H13N5O and a molecular weight of 183.21 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(1-aminobutan-2-yl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 65193517 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | N-(1-aminobutan-2-yl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCC(CN)NC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H13N5O/c1-2-5(3-8)11-7(13)6-9-4-10-12-6/h4-5H,2-3,8H2,1H3,(H,11,13)(H,9,10,12) |
| InChIKey | CXUMXUISMDXAQB-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |