C3H5N5O — CID 2760675
1H-1,2,4-triazole-5-carbohydrazide (PubChem CID 2760675) has the molecular formula C3H5N5O and a molecular weight of 127.11 g/mol. Its IUPAC name is 1H-1,2,4-triazole-5-carbohydrazide.
| Compound Name | 1H-1,2,4-triazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2760675 |
| Molecular Formula | C3H5N5O |
| Molecular Weight | 127.11 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 1H-1,2,4-triazole-5-carbohydrazide |
| SMILES | NNC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C3H5N5O/c4-7-3(9)2-5-1-6-8-2/h1H,4H2,(H,7,9)(H,5,6,8) |
| InChIKey | BKTBECSWYCHYID-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.11 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|