C6H8N4O2 — CID 155075039
N-prop-2-enoxy-1H-1,2,4-triazole-5-carboxamide (PubChem CID 155075039) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is N-prop-2-enoxy-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-prop-2-enoxy-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 155075039 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | N-prop-2-enoxy-1H-1,2,4-triazole-5-carboxamide |
| SMILES | C=CCONC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H8N4O2/c1-2-3-12-10-6(11)5-7-4-8-9-5/h2,4H,1,3H2,(H,10,11)(H,7,8,9) |
| InChIKey | ZNFJXHWFKOTKOB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|