C7H9N3O — CID 79177579
3-methyl-1-(1H-1,2,4-triazol-5-yl)but-3-en-1-one (PubChem CID 79177579) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is 3-methyl-1-(1H-1,2,4-triazol-5-yl)but-3-en-1-one.
| Compound Name | 3-methyl-1-(1H-1,2,4-triazol-5-yl)but-3-en-1-one |
|---|---|
| PubChem CID | 79177579 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 3-methyl-1-(1H-1,2,4-triazol-5-yl)but-3-en-1-one |
| SMILES | C=C(C)CC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H9N3O/c1-5(2)3-6(11)7-8-4-9-10-7/h4H,1,3H2,2H3,(H,8,9,10) |
| InChIKey | MEDZXVZSVHQPIL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|