About 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one
3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one (PubChem CID 65363335) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one.
Molecular Properties
| Compound Name | 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one |
| PubChem CID | 65363335 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one |
| SMILES | CCC(C)CC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C8H13N3O/c1-3-6(2)4-7(12)8-9-5-10-11-8/h5-6H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | QGDDPPASVOWDKO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one?
The IUPAC name of 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one (CID 65363335) is 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one.
What is the SMILES notation for 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one?
The canonical SMILES for 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one is CCC(C)CC(=O)c1ncn[nH]1.
What is the InChIKey of 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one?
The InChIKey is QGDDPPASVOWDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-3-6(2)4-7(12)8-9-5-10-11-8/h5-6H,3-4H2,1-2H3,(H,9,10,11).
What are the key properties of 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one?
3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one has a molecular weight of 167.21 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one is sourced from PubChem (CID 65363335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).