C8H13N3O — CID 65363335
3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one (PubChem CID 65363335) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one.
| Compound Name | 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one |
|---|---|
| PubChem CID | 65363335 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-methyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-one |
| SMILES | CCC(C)CC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C8H13N3O/c1-3-6(2)4-7(12)8-9-5-10-11-8/h5-6H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | QGDDPPASVOWDKO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |