C6H10N4O2 — CID 103886008
N-[(2R)-2-hydroxypropyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 103886008) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 103886008 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | C[C@@H](O)CNC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H10N4O2/c1-4(11)2-7-6(12)5-8-3-9-10-5/h3-4,11H,2H2,1H3,(H,7,12)(H,8,9,10)/t4-/m1/s1 |
| InChIKey | OLQRNRNYXBTVNK-SCSAIBSYSA-N |
| XLogP | -1.08 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |