2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid

C7H10N4O4 — CID 107831797

IUPAC2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid
SMILESO=C(NCCC(O)C(=O)O)c1ncn[nH]1
InChIInChI=1S/C7H10N4O4/c12-4(7(14)15)1-2-8-6(13)5-9-3-10-11-5/h3-4,12H,1-2H2,(H,8,13)(H,14,15)(H,9,10,11)
InChIKeyBPOPCWPHMOJCRQ-UHFFFAOYSA-N
MW214.18 g/mol
LogP-1.63
Rot. Bonds5

About 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid

2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid (PubChem CID 107831797) has the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid.

Molecular Properties

Compound Name2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid
PubChem CID107831797
Molecular FormulaC7H10N4O4
Molecular Weight214.18 g/mol
Exact Mass214.07
IUPAC Name2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid
SMILESO=C(NCCC(O)C(=O)O)c1ncn[nH]1
InChIInChI=1S/C7H10N4O4/c12-4(7(14)15)1-2-8-6(13)5-9-3-10-11-5/h3-4,12H,1-2H2,(H,8,13)(H,14,15)(H,9,10,11)
InChIKeyBPOPCWPHMOJCRQ-UHFFFAOYSA-N
XLogP-1.63
TPSA128.20 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.18
LogP ≤ 5-1.63
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid?
The IUPAC name of 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid (CID 107831797) is 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid.
What is the SMILES notation for 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid?
The canonical SMILES for 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid is O=C(NCCC(O)C(=O)O)c1ncn[nH]1.
What is the InChIKey of 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid?
The InChIKey is BPOPCWPHMOJCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O4/c12-4(7(14)15)1-2-8-6(13)5-9-3-10-11-5/h3-4,12H,1-2H2,(H,8,13)(H,14,15)(H,9,10,11).
What are the key properties of 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid?
2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid has a molecular weight of 214.18 g/mol, XLogP of -1.63, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-(1H-1,2,4-triazole-5-carbonylamino)butanoic acid is sourced from PubChem (CID 107831797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).