C9H11N3O5 — CID 107832681
2-hydroxy-4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]butanoic acid (PubChem CID 107832681) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 2-hydroxy-4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]butanoic acid.
| Compound Name | 2-hydroxy-4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107832681 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-hydroxy-4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]butanoic acid |
| SMILES | O=C(NCCC(O)C(=O)O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C9H11N3O5/c13-6(9(16)17)3-4-10-8(15)5-1-2-7(14)12-11-5/h1-2,6,13H,3-4H2,(H,10,15)(H,12,14)(H,16,17) |
| InChIKey | GSIOGKKHXFHFCX-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |