C12H17N3O5 — CID 107831909
2-hydroxy-4-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoic acid (PubChem CID 107831909) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-hydroxy-4-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoic acid.
| Compound Name | 2-hydroxy-4-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107831909 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-hydroxy-4-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoic acid |
| SMILES | CCCn1nc(C(=O)NCCC(O)C(=O)O)ccc1=O |
| InChI | InChI=1S/C12H17N3O5/c1-2-7-15-10(17)4-3-8(14-15)11(18)13-6-5-9(16)12(19)20/h3-4,9,16H,2,5-7H2,1H3,(H,13,18)(H,19,20) |
| InChIKey | JTXWDOYXQJPNPL-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |