C24H27N3O2 — CID 42162037
1-butyl-N-(3,3-diphenylpropyl)-6-oxopyridazine-3-carboxamide (PubChem CID 42162037) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-butyl-N-(3,3-diphenylpropyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-(3,3-diphenylpropyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 42162037 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-butyl-N-(3,3-diphenylpropyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)NCCC(c2ccccc2)c2ccccc2)ccc1=O |
| InChI | InChI=1S/C24H27N3O2/c1-2-3-18-27-23(28)15-14-22(26-27)24(29)25-17-16-21(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15,21H,2-3,16-18H2,1H3,(H,25,29) |
| InChIKey | PGNJXOGLDSGRFJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |