C15H25N3O3 — CID 103862339
1-butyl-N-(5-hydroxy-4-methylpentyl)-6-oxopyridazine-3-carboxamide (PubChem CID 103862339) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-butyl-N-(5-hydroxy-4-methylpentyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-(5-hydroxy-4-methylpentyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103862339 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-butyl-N-(5-hydroxy-4-methylpentyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)NCCCC(C)CO)ccc1=O |
| InChI | InChI=1S/C15H25N3O3/c1-3-4-10-18-14(20)8-7-13(17-18)15(21)16-9-5-6-12(2)11-19/h7-8,12,19H,3-6,9-11H2,1-2H3,(H,16,21) |
| InChIKey | QRJQWZXEGFWTNU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|