C13H19N3O5 — CID 107832412
4-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-2-hydroxybutanoic acid (PubChem CID 107832412) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-2-hydroxybutanoic acid.
| Compound Name | 4-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107832412 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-2-hydroxybutanoic acid |
| SMILES | CCCCn1nc(C(=O)NCCC(O)C(=O)O)ccc1=O |
| InChI | InChI=1S/C13H19N3O5/c1-2-3-8-16-11(18)5-4-9(15-16)12(19)14-7-6-10(17)13(20)21/h4-5,10,17H,2-3,6-8H2,1H3,(H,14,19)(H,20,21) |
| InChIKey | HOGKEAFIVULTMY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |