C14H23N3O3S — CID 103767607
1-butyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-6-oxopyridazine-3-carboxamide (PubChem CID 103767607) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-butyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103767607 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-butyl-N-[2-(3-hydroxypropylsulfanyl)ethyl]-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)NCCSCCCO)ccc1=O |
| InChI | InChI=1S/C14H23N3O3S/c1-2-3-8-17-13(19)6-5-12(16-17)14(20)15-7-11-21-10-4-9-18/h5-6,18H,2-4,7-11H2,1H3,(H,15,20) |
| InChIKey | ZIJONDCPMCWKDY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|