C13H19N3O4 — CID 43630891
2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]pentanoic acid (PubChem CID 43630891) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 43630891 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1ccc(=O)n(CCC)n1)C(=O)O |
| InChI | InChI=1S/C13H19N3O4/c1-3-5-10(13(19)20)14-12(18)9-6-7-11(17)16(15-9)8-4-2/h6-7,10H,3-5,8H2,1-2H3,(H,14,18)(H,19,20) |
| InChIKey | ZROXHYFRZLQECQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |