C12H17N3O5 — CID 81077374
3-methoxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid (PubChem CID 81077374) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-methoxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-methoxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 81077374 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-methoxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid |
| SMILES | CCCn1nc(C(=O)NC(COC)C(=O)O)ccc1=O |
| InChI | InChI=1S/C12H17N3O5/c1-3-6-15-10(16)5-4-8(14-15)11(17)13-9(7-20-2)12(18)19/h4-5,9H,3,6-7H2,1-2H3,(H,13,17)(H,18,19) |
| InChIKey | GLUJCXYDQFRLPF-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |