C14H21N3O4 — CID 87040055
methyl (2S)-3-methyl-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoate (PubChem CID 87040055) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 87040055 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | methyl (2S)-3-methyl-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]butanoate |
| SMILES | CCCn1nc(C(=O)N[C@H](C(=O)OC)C(C)C)ccc1=O |
| InChI | InChI=1S/C14H21N3O4/c1-5-8-17-11(18)7-6-10(16-17)13(19)15-12(9(2)3)14(20)21-4/h6-7,9,12H,5,8H2,1-4H3,(H,15,19)/t12-/m0/s1 |
| InChIKey | RNRXKKMEGAAMQV-LBPRGKRZSA-N |
| XLogP | 0.58 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |