C11H15N3O5 — CID 61151604
(2S)-3-hydroxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid (PubChem CID 61151604) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 61151604 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | (2S)-3-hydroxy-2-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoic acid |
| SMILES | CCCn1nc(C(=O)N[C@@H](CO)C(=O)O)ccc1=O |
| InChI | InChI=1S/C11H15N3O5/c1-2-5-14-9(16)4-3-7(13-14)10(17)12-8(6-15)11(18)19/h3-4,8,15H,2,5-6H2,1H3,(H,12,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | DMHLTMPDFUNTAQ-QMMMGPOBSA-N |
| XLogP | -1.17 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |