C12H17N3O5 — CID 103879096
methyl 2-hydroxy-3-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoate (PubChem CID 103879096) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 103879096 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 2-hydroxy-3-[(6-oxo-1-propylpyridazine-3-carbonyl)amino]propanoate |
| SMILES | CCCn1nc(C(=O)NCC(O)C(=O)OC)ccc1=O |
| InChI | InChI=1S/C12H17N3O5/c1-3-6-15-10(17)5-4-8(14-15)11(18)13-7-9(16)12(19)20-2/h4-5,9,16H,3,6-7H2,1-2H3,(H,13,18) |
| InChIKey | PVMFODWXXLKFMS-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |