C14H14N4O4 — CID 108573584
phenyl N-[2-[(6-oxo-1H-pyridazine-3-carbonyl)amino]ethyl]carbamate (PubChem CID 108573584) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is phenyl N-[2-[(6-oxo-1H-pyridazine-3-carbonyl)amino]ethyl]carbamate.
| Compound Name | phenyl N-[2-[(6-oxo-1H-pyridazine-3-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108573584 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | phenyl N-[2-[(6-oxo-1H-pyridazine-3-carbonyl)amino]ethyl]carbamate |
| SMILES | O=C(NCCNC(=O)c1ccc(=O)[nH]n1)Oc1ccccc1 |
| InChI | InChI=1S/C14H14N4O4/c19-12-7-6-11(17-18-12)13(20)15-8-9-16-14(21)22-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,15,20)(H,16,21)(H,18,19) |
| InChIKey | WXCBKFOCTZXPAI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|