C8H14N4OS — CID 115749145
N-(4-methylsulfanylbutyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 115749145) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(4-methylsulfanylbutyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 115749145 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(4-methylsulfanylbutyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CSCCCCNC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C8H14N4OS/c1-14-5-3-2-4-9-8(13)7-10-6-11-12-7/h6H,2-5H2,1H3,(H,9,13)(H,10,11,12) |
| InChIKey | LVHWZTBLAHGOAU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|