C7H12N4O — CID 3345983
N,N-diethyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 3345983) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is N,N-diethyl-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N,N-diethyl-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 3345983 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N,N-diethyl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C7H12N4O/c1-3-11(4-2)7(12)6-8-5-9-10-6/h5H,3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | QYDINIGGCZMHIP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |