About (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone
(1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 130508831) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone.
Molecular Properties
| Compound Name | (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| PubChem CID | 130508831 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | CCn1cnc(C(=O)c2ncn[nH]2)c1 |
| InChI | InChI=1S/C8H9N5O/c1-2-13-3-6(10-5-13)7(14)8-9-4-11-12-8/h3-5H,2H2,1H3,(H,9,11,12) |
| InChIKey | XWRYXWXHDCOYQP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The IUPAC name of (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone (CID 130508831) is (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone.
What is the SMILES notation for (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The canonical SMILES for (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone is CCn1cnc(C(=O)c2ncn[nH]2)c1.
What is the InChIKey of (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The InChIKey is XWRYXWXHDCOYQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c1-2-13-3-6(10-5-13)7(14)8-9-4-11-12-8/h3-5H,2H2,1H3,(H,9,11,12).
What are the key properties of (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone?
(1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone has a molecular weight of 191.19 g/mol, XLogP of 0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylimidazol-4-yl)-(1H-1,2,4-triazol-5-yl)methanone is sourced from PubChem (CID 130508831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).