C6H7N5O2S — CID 4619516
N-(acetylcarbamothioyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 4619516) has the molecular formula C6H7N5O2S and a molecular weight of 213.22 g/mol. Its IUPAC name is N-(acetylcarbamothioyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-(acetylcarbamothioyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 4619516 |
| Molecular Formula | C6H7N5O2S |
| Molecular Weight | 213.22 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | N-(acetylcarbamothioyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CC(=O)NC(=S)NC(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C6H7N5O2S/c1-3(12)9-6(14)10-5(13)4-7-2-8-11-4/h2H,1H3,(H,7,8,11)(H2,9,10,12,13,14) |
| InChIKey | UPZNYQKSALPDCY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.22 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|