C8H12N4O3 — CID 63654513
2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid (PubChem CID 63654513) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid.
| Compound Name | 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 63654513 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid |
| SMILES | CCCC(NC(=O)c1ncn[nH]1)C(=O)O |
| InChI | InChI=1S/C8H12N4O3/c1-2-3-5(8(14)15)11-7(13)6-9-4-10-12-6/h4-5H,2-3H2,1H3,(H,11,13)(H,14,15)(H,9,10,12) |
| InChIKey | MKTHOZOYNVFFBP-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |