2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid

C8H12N4O3 — CID 63654513

IUPAC2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid
SMILESCCCC(NC(=O)c1ncn[nH]1)C(=O)O
InChIInChI=1S/C8H12N4O3/c1-2-3-5(8(14)15)11-7(13)6-9-4-10-12-6/h4-5H,2-3H2,1H3,(H,11,13)(H,14,15)(H,9,10,12)
InChIKeyMKTHOZOYNVFFBP-UHFFFAOYSA-N
MW212.21 g/mol
LogP-0.21
Rot. Bonds5

About 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid

2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid (PubChem CID 63654513) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid.

Molecular Properties

Compound Name2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid
PubChem CID63654513
Molecular FormulaC8H12N4O3
Molecular Weight212.21 g/mol
Exact Mass212.09
IUPAC Name2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid
SMILESCCCC(NC(=O)c1ncn[nH]1)C(=O)O
InChIInChI=1S/C8H12N4O3/c1-2-3-5(8(14)15)11-7(13)6-9-4-10-12-6/h4-5H,2-3H2,1H3,(H,11,13)(H,14,15)(H,9,10,12)
InChIKeyMKTHOZOYNVFFBP-UHFFFAOYSA-N
XLogP-0.21
TPSA107.97 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.21
LogP ≤ 5-0.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid?
The IUPAC name of 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid (CID 63654513) is 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid.
What is the SMILES notation for 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid?
The canonical SMILES for 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid is CCCC(NC(=O)c1ncn[nH]1)C(=O)O.
What is the InChIKey of 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid?
The InChIKey is MKTHOZOYNVFFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3/c1-2-3-5(8(14)15)11-7(13)6-9-4-10-12-6/h4-5H,2-3H2,1H3,(H,11,13)(H,14,15)(H,9,10,12).
What are the key properties of 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid?
2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid has a molecular weight of 212.21 g/mol, XLogP of -0.21, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,2,4-triazole-5-carbonylamino)pentanoic acid is sourced from PubChem (CID 63654513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).