C9H15N5O4 — CID 80756005
(2R)-3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]propanoic acid (PubChem CID 80756005) has the molecular formula C9H15N5O4 and a molecular weight of 257.25 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 80756005 |
| Molecular Formula | C9H15N5O4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2R)-3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]propanoic acid |
| SMILES | O=C(NCCCc1ncn[nH]1)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C9H15N5O4/c15-4-6(8(16)17)13-9(18)10-3-1-2-7-11-5-12-14-7/h5-6,15H,1-4H2,(H,16,17)(H2,10,13,18)(H,11,12,14)/t6-/m1/s1 |
| InChIKey | MGGVRUBOINMRPE-ZCFIWIBFSA-N |
| XLogP | -1.52 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|