C11H19N5O3 — CID 104686734
2-methyl-5-[2-(1H-1,2,4-triazol-5-yl)ethylcarbamoylamino]pentanoic acid (PubChem CID 104686734) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-methyl-5-[2-(1H-1,2,4-triazol-5-yl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | 2-methyl-5-[2-(1H-1,2,4-triazol-5-yl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 104686734 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-methyl-5-[2-(1H-1,2,4-triazol-5-yl)ethylcarbamoylamino]pentanoic acid |
| SMILES | CC(CCCNC(=O)NCCc1ncn[nH]1)C(=O)O |
| InChI | InChI=1S/C11H19N5O3/c1-8(10(17)18)3-2-5-12-11(19)13-6-4-9-14-7-15-16-9/h7-8H,2-6H2,1H3,(H,17,18)(H2,12,13,19)(H,14,15,16) |
| InChIKey | MOYIHLAZLLMIRU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|