C12H23N5O — CID 65291250
6-amino-2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]heptanamide (PubChem CID 65291250) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 6-amino-2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]heptanamide.
| Compound Name | 6-amino-2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]heptanamide |
|---|---|
| PubChem CID | 65291250 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 6-amino-2-methyl-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]heptanamide |
| SMILES | CC(N)CCCC(C)C(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C12H23N5O/c1-9(4-3-5-10(2)13)12(18)14-7-6-11-15-8-16-17-11/h8-10H,3-7,13H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | KNAFEAGZGOSWBG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |