C11H21N5O — CID 64532327
(2S,3S)-2-amino-3-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pentanamide (PubChem CID 64532327) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is (2S,3S)-2-amino-3-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pentanamide.
| Compound Name | (2S,3S)-2-amino-3-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 64532327 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2S,3S)-2-amino-3-methyl-N-[3-(1H-1,2,4-triazol-5-yl)propyl]pentanamide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C11H21N5O/c1-3-8(2)10(12)11(17)13-6-4-5-9-14-7-15-16-9/h7-8,10H,3-6,12H2,1-2H3,(H,13,17)(H,14,15,16)/t8-,10-/m0/s1 |
| InChIKey | YMZOPZBCOQLPLP-WPRPVWTQSA-N |
| XLogP | 0.23 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|