C14H17FN4O2 — CID 64548620
2-(4-fluorophenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide (PubChem CID 64548620) has the molecular formula C14H17FN4O2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide |
|---|---|
| PubChem CID | 64548620 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]propanamide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C14H17FN4O2/c1-10(21-12-6-4-11(15)5-7-12)14(20)16-8-2-3-13-17-9-18-19-13/h4-7,9-10H,2-3,8H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | LUESUMKZRMSYSV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|