C10H17N5O4 — CID 64529603
3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid (PubChem CID 64529603) has the molecular formula C10H17N5O4 and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid.
| Compound Name | 3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 64529603 |
| Molecular Formula | C10H17N5O4 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 3-hydroxy-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid |
| SMILES | CC(O)C(NC(=O)NCCCc1ncn[nH]1)C(=O)O |
| InChI | InChI=1S/C10H17N5O4/c1-6(16)8(9(17)18)14-10(19)11-4-2-3-7-12-5-13-15-7/h5-6,8,16H,2-4H2,1H3,(H,17,18)(H2,11,14,19)(H,12,13,15) |
| InChIKey | NIDVGEVCWLXMDJ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|