C10H16N6O4 — CID 64530595
4-amino-4-oxo-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid (PubChem CID 64530595) has the molecular formula C10H16N6O4 and a molecular weight of 284.28 g/mol. Its IUPAC name is 4-amino-4-oxo-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid.
| Compound Name | 4-amino-4-oxo-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 64530595 |
| Molecular Formula | C10H16N6O4 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-amino-4-oxo-2-[3-(1H-1,2,4-triazol-5-yl)propylcarbamoylamino]butanoic acid |
| SMILES | NC(=O)CC(NC(=O)NCCCc1ncn[nH]1)C(=O)O |
| InChI | InChI=1S/C10H16N6O4/c11-7(17)4-6(9(18)19)15-10(20)12-3-1-2-8-13-5-14-16-8/h5-6H,1-4H2,(H2,11,17)(H,18,19)(H2,12,15,20)(H,13,14,16) |
| InChIKey | HOAXFAAYPTWBJR-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 163.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|