C8H14N6O2 — CID 64529554
2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanediamide (PubChem CID 64529554) has the molecular formula C8H14N6O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanediamide.
| Compound Name | 2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanediamide |
|---|---|
| PubChem CID | 64529554 |
| Molecular Formula | C8H14N6O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-amino-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C8H14N6O2/c9-5(3-6(10)15)8(16)11-2-1-7-12-4-13-14-7/h4-5H,1-3,9H2,(H2,10,15)(H,11,16)(H,12,13,14) |
| InChIKey | REVGZABOZMXAQZ-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |