C6H13N7 — CID 104882301
1-amino-2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine (PubChem CID 104882301) has the molecular formula C6H13N7 and a molecular weight of 183.22 g/mol. Its IUPAC name is 1-amino-2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine.
| Compound Name | 1-amino-2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 104882301 |
| Molecular Formula | C6H13N7 |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 1-amino-2-methyl-3-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
| SMILES | C/N=C(\NN)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C6H13N7/c1-8-6(12-7)9-3-2-5-10-4-11-13-5/h4H,2-3,7H2,1H3,(H2,8,9,12)(H,10,11,13) |
| InChIKey | HRVMSKVYLFGGJK-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|