About 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine
1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine (PubChem CID 64874829) has the molecular formula C5H11N7
and a molecular weight of 169.19 g/mol. Its IUPAC name is 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine.
Molecular Properties
| Compound Name | 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
| PubChem CID | 64874829 |
| Molecular Formula | C5H11N7 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine |
| SMILES | NN/C(N)=N/CCc1ncn[nH]1 |
| InChI | InChI=1S/C5H11N7/c6-5(11-7)8-2-1-4-9-3-10-12-4/h3H,1-2,7H2,(H3,6,8,11)(H,9,10,12) |
| InChIKey | ZAMHKWWMRJCSFM-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine?
The IUPAC name of 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine (CID 64874829) is 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine.
What is the SMILES notation for 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine?
The canonical SMILES for 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine is NN/C(N)=N/CCc1ncn[nH]1.
What is the InChIKey of 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine?
The InChIKey is ZAMHKWWMRJCSFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N7/c6-5(11-7)8-2-1-4-9-3-10-12-4/h3H,1-2,7H2,(H3,6,8,11)(H,9,10,12).
What are the key properties of 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine?
1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine has a molecular weight of 169.19 g/mol, XLogP of -1.87, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-[2-(1H-1,2,4-triazol-5-yl)ethyl]guanidine is sourced from PubChem (CID 64874829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).