C6H13IN6 — CID 130616377
1,1-dimethyl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 130616377) has the molecular formula C6H13IN6 and a molecular weight of 296.12 g/mol. Its IUPAC name is 1,1-dimethyl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,1-dimethyl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 130616377 |
| Molecular Formula | C6H13IN6 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1,1-dimethyl-2-(1H-1,2,4-triazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | CN(C)/C(N)=N/Cc1ncn[nH]1.I |
| InChI | InChI=1S/C6H12N6.HI/c1-12(2)6(7)8-3-5-9-4-10-11-5;/h4H,3H2,1-2H3,(H2,7,8)(H,9,10,11);1H |
| InChIKey | XGTSWZVLUNFUFM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|