C4H6N4S — CID 131121035
2-(1H-1,2,4-triazol-5-yl)ethanethioamide (PubChem CID 131121035) has the molecular formula C4H6N4S and a molecular weight of 142.19 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-yl)ethanethioamide.
| Compound Name | 2-(1H-1,2,4-triazol-5-yl)ethanethioamide |
|---|---|
| PubChem CID | 131121035 |
| Molecular Formula | C4H6N4S |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-yl)ethanethioamide |
| SMILES | NC(=S)Cc1ncn[nH]1 |
| InChI | InChI=1S/C4H6N4S/c5-3(9)1-4-6-2-7-8-4/h2H,1H2,(H2,5,9)(H,6,7,8) |
| InChIKey | SMELLBKQVHINIW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|