C14H24N6 — CID 169210020
5-[10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole (PubChem CID 169210020) has the molecular formula C14H24N6 and a molecular weight of 276.39 g/mol. Its IUPAC name is 5-[10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole.
| Compound Name | 5-[10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 169210020 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 5-[10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole |
| SMILES | c1n[nH]c(CCCCCCCCCCc2ncn[nH]2)n1 |
| InChI | InChI=1S/C14H24N6/c1(3-5-7-9-13-15-11-17-19-13)2-4-6-8-10-14-16-12-18-20-14/h11-12H,1-10H2,(H,15,17,19)(H,16,18,20) |
| InChIKey | DNHAZZWMXCBSBO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|