C9H15N3O — CID 159797633
2-methyl-6-(1H-1,2,4-triazol-5-yl)hexan-3-one (PubChem CID 159797633) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-methyl-6-(1H-1,2,4-triazol-5-yl)hexan-3-one.
| Compound Name | 2-methyl-6-(1H-1,2,4-triazol-5-yl)hexan-3-one |
|---|---|
| PubChem CID | 159797633 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-methyl-6-(1H-1,2,4-triazol-5-yl)hexan-3-one |
| SMILES | CC(C)C(=O)CCCc1ncn[nH]1 |
| InChI | InChI=1S/C9H15N3O/c1-7(2)8(13)4-3-5-9-10-6-11-12-9/h6-7H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | BCEKTFNWVNYLAM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |