C16H28N6 — CID 169210026
5-[5-ethyl-10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole (PubChem CID 169210026) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-[5-ethyl-10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole.
| Compound Name | 5-[5-ethyl-10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 169210026 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 5-[5-ethyl-10-(1H-1,2,4-triazol-5-yl)decyl]-1H-1,2,4-triazole |
| SMILES | CCC(CCCCCc1ncn[nH]1)CCCCc1ncn[nH]1 |
| InChI | InChI=1S/C16H28N6/c1-2-14(9-6-7-11-16-18-13-20-22-16)8-4-3-5-10-15-17-12-19-21-15/h12-14H,2-11H2,1H3,(H,17,19,21)(H,18,20,22) |
| InChIKey | UCBGLAVQKDEANS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|