C19H36N4 — CID 129069584
1-(1H-1,2,4-triazol-5-yl)heptadec-3-en-5-amine (PubChem CID 129069584) has the molecular formula C19H36N4 and a molecular weight of 320.53 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)heptadec-3-en-5-amine.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)heptadec-3-en-5-amine |
|---|---|
| PubChem CID | 129069584 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)heptadec-3-en-5-amine |
| SMILES | CCCCCCCCCCCCC(N)C=CCCc1ncn[nH]1 |
| InChI | InChI=1S/C19H36N4/c1-2-3-4-5-6-7-8-9-10-11-14-18(20)15-12-13-16-19-21-17-22-23-19/h12,15,17-18H,2-11,13-14,16,20H2,1H3,(H,21,22,23) |
| InChIKey | DHJQMDOHRNDIAV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|