C20H39N3 — CID 157179819
5-octadecan-2-yl-1H-1,2,4-triazole (PubChem CID 157179819) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 5-octadecan-2-yl-1H-1,2,4-triazole.
| Compound Name | 5-octadecan-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 157179819 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 5-octadecan-2-yl-1H-1,2,4-triazole |
| SMILES | CCCCCCCCCCCCCCCCC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C20H39N3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(2)20-21-18-22-23-20/h18-19H,3-17H2,1-2H3,(H,21,22,23) |
| InChIKey | NONFWTAOQVEGES-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|