C8H15N3 — CID 122599049
5-hexan-2-yl-1H-1,2,4-triazole (PubChem CID 122599049) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 5-hexan-2-yl-1H-1,2,4-triazole.
| Compound Name | 5-hexan-2-yl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 122599049 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 5-hexan-2-yl-1H-1,2,4-triazole |
| SMILES | CCCCC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C8H15N3/c1-3-4-5-7(2)8-9-6-10-11-8/h6-7H,3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | BDPRYYVTHGRDLG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |