C7H14N4 — CID 65360719
N-methyl-1-(1H-1,2,4-triazol-5-yl)butan-1-amine (PubChem CID 65360719) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is N-methyl-1-(1H-1,2,4-triazol-5-yl)butan-1-amine.
| Compound Name | N-methyl-1-(1H-1,2,4-triazol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 65360719 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | N-methyl-1-(1H-1,2,4-triazol-5-yl)butan-1-amine |
| SMILES | CCCC(NC)c1ncn[nH]1 |
| InChI | InChI=1S/C7H14N4/c1-3-4-6(8-2)7-9-5-10-11-7/h5-6,8H,3-4H2,1-2H3,(H,9,10,11) |
| InChIKey | QUFAYMPCCCXGJI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |