C14H28N4 — CID 65360398
N-ethyl-1-(1H-1,2,4-triazol-5-yl)decan-1-amine (PubChem CID 65360398) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N-ethyl-1-(1H-1,2,4-triazol-5-yl)decan-1-amine.
| Compound Name | N-ethyl-1-(1H-1,2,4-triazol-5-yl)decan-1-amine |
|---|---|
| PubChem CID | 65360398 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N-ethyl-1-(1H-1,2,4-triazol-5-yl)decan-1-amine |
| SMILES | CCCCCCCCCC(NCC)c1ncn[nH]1 |
| InChI | InChI=1S/C14H28N4/c1-3-5-6-7-8-9-10-11-13(15-4-2)14-16-12-17-18-14/h12-13,15H,3-11H2,1-2H3,(H,16,17,18) |
| InChIKey | QZHLLKSQLNFUBT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|