C9H18N4 — CID 65362730
N,4-dimethyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-amine (PubChem CID 65362730) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is N,4-dimethyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-amine.
| Compound Name | N,4-dimethyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 65362730 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N,4-dimethyl-1-(1H-1,2,4-triazol-5-yl)pentan-1-amine |
| SMILES | CNC(CCC(C)C)c1ncn[nH]1 |
| InChI | InChI=1S/C9H18N4/c1-7(2)4-5-8(10-3)9-11-6-12-13-9/h6-8,10H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | NEOWTFFZXNUFSU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |