C11H22N4 — CID 106281815
5-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexan-2-amine (PubChem CID 106281815) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexan-2-amine.
| Compound Name | 5-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexan-2-amine |
|---|---|
| PubChem CID | 106281815 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 5-methyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]hexan-2-amine |
| SMILES | CC(C)CCC(C)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C11H22N4/c1-8(2)5-6-9(3)14-10(4)11-12-7-13-15-11/h7-10,14H,5-6H2,1-4H3,(H,12,13,15) |
| InChIKey | IQOOCIPXKAOOFS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |