C13H25N3 — CID 115970276
5-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]hexan-2-amine (PubChem CID 115970276) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 5-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]hexan-2-amine.
| Compound Name | 5-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]hexan-2-amine |
|---|---|
| PubChem CID | 115970276 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 5-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]hexan-2-amine |
| SMILES | Cc1[nH]ncc1C(C)NC(C)CCC(C)C |
| InChI | InChI=1S/C13H25N3/c1-9(2)6-7-10(3)15-11(4)13-8-14-16-12(13)5/h8-11,15H,6-7H2,1-5H3,(H,14,16) |
| InChIKey | IJFUHFHOHKYGIF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |