C11H21N3 — CID 115970374
3-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]butan-2-amine (PubChem CID 115970374) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]butan-2-amine.
| Compound Name | 3-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 115970374 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 3-methyl-N-[1-(5-methyl-1H-pyrazol-4-yl)ethyl]butan-2-amine |
| SMILES | Cc1[nH]ncc1C(C)NC(C)C(C)C |
| InChI | InChI=1S/C11H21N3/c1-7(2)8(3)13-9(4)11-6-12-14-10(11)5/h6-9,13H,1-5H3,(H,12,14) |
| InChIKey | TZNCZVPKZWAAJA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |